Compound Q&A

What are the main uses of Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7)?

Answer

Naratriptan-d3 Hydrochloride
Naratriptan-d3 Hydrochloride is primarily used in the pharmaceutical industry for the research and development of naratriptan. It is also utilized in analytical laboratories to improve the detection and quantification of naratriptan in various matrices such as blood, urine, and plasma samples.

About

English Name Naratriptan-d3 Hydrochloride
Molecular Formula C17H23ClD3N3O2S
Molecular Weight 374.95 g/mol
SMILES CNS(=O)(=O)CCc1ccc2c(c1)c(c[nH]2)C1CCN(CC1)C([2H])([2H])[2H].Cl
InChIKey AWEZYKMQFAUBTD-MUTAZJQDSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7)?

Naratriptan-d3 Hydrochloride is a stable isotope-labeled compound used in the research and developme...

Compound Q&A

Is Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7) safe?

Naratriptan-d3 Hydrochloride is generally considered safe when handled with proper safety precaution...

Compound Q&A

How should Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7) be stored?

Naratriptan-d3 Hydrochloride should be stored in a tightly sealed container to protect it from moist...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...