Compound Q&A

Is 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2) safe?

Answer

7-Xylosyl-10-deacetyltaxol B
7-Xylosyl-10-deacetyltaxol B is generally considered safe when handled properly. However, it is important to follow safety guidelines, including wearing appropriate protective gear and avoiding contact with skin and eyes. Safe storage and disposal procedures should also be followed to prevent environmental contamination.

About

CAS No 90332-64-2
English Name 7-Xylosyl-10-deacetyltaxol B
Molecular Formula C48H59NO17
Molecular Weight 921.99 g/mol
SMILES CC=C(C)C(=O)NC(C1=CC=CC=C1)C(C(=O)OC2CC3(C(C4C(C(CC5C4(CO5)OC(=O)C)OC6C(C(C(CO6)O)O)O)(C(=O)C(C(=C2C)C3(C)C)O)C)OC(=O)C7=CC=CC=C7)O)O
InChIKey YAOWLIDDDUBAEI-LWKZJDLTSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2)?

7-Xylosyl-10-deacetyltaxol B is a semi-synthetic derivative of taxol with a unique chemical structur...

Compound Q&A

What are the main uses of 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2)?

7-Xylosyl-10-deacetyltaxol B is primarily used in research for studying taxol derivatives and their ...

Compound Q&A

How should 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2) be stored?

7-Xylosyl-10-deacetyltaxol B should be stored in a cool, dry place away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...