Compound Q&A

What are the main uses of 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2)?

Answer

7-Xylosyl-10-deacetyltaxol B
7-Xylosyl-10-deacetyltaxol B is primarily used in research for studying taxol derivatives and their anticancer properties. It may also have potential applications in developing new anti-cancer drugs, but further studies are needed to confirm its therapeutic value.

About

CAS No 90332-64-2
English Name 7-Xylosyl-10-deacetyltaxol B
Molecular Formula C48H59NO17
Molecular Weight 921.99 g/mol
SMILES CC=C(C)C(=O)NC(C1=CC=CC=C1)C(C(=O)OC2CC3(C(C4C(C(CC5C4(CO5)OC(=O)C)OC6C(C(C(CO6)O)O)O)(C(=O)C(C(=C2C)C3(C)C)O)C)OC(=O)C7=CC=CC=C7)O)O
InChIKey YAOWLIDDDUBAEI-LWKZJDLTSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2)?

7-Xylosyl-10-deacetyltaxol B is a semi-synthetic derivative of taxol with a unique chemical structur...

Compound Q&A

Is 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2) safe?

7-Xylosyl-10-deacetyltaxol B is generally considered safe when handled properly. However, it is impo...

Compound Q&A

How should 7-Xylosyl-10-deacetyltaxol B (CAS: 90332-64-2) be stored?

7-Xylosyl-10-deacetyltaxol B should be stored in a cool, dry place away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...