Compound Q&A

What industries use 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0)?

Answer

4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid
4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid is used in various industries, including pharmaceuticals for the synthesis of certain drugs, and in the production of high-performance polymers. It also finds applications in the development of sensors and semiconductors due to its unique chemical structure.

About

English Name 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid
Molecular Formula C19H13NO4
Molecular Weight 319.32 g/mol
SMILES O=C(O)C1=CC(C(O)=O)=CC(C2=CC=C(C=C2)C3=CC=NC=C3)=C1
InChIKey ZCPSJVXVYUXFHI-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0)?

4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid is a solid with a white crystalline appearance. It ha...

Compound Q&A

How is 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0) typically synthesized?

4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid can be synthesized via the condensation of 2,5-biphen...

Compound Q&A

What precautions should be taken when handling 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0)?

When handling 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid, it is essential to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...