Compound Q&A

What are the physical and chemical properties of 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0)?

Answer

4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid
4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid is a solid with a white crystalline appearance. It has a molecular weight of 327.13 g/mol and is poorly soluble in water. This compound is susceptible to hydrolysis and oxidation under acidic or basic conditions. It is stable under normal atmospheric conditions but should be stored in a cool, dry place away from moisture and strong acids or bases.

About

English Name 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid
Molecular Formula C19H13NO4
Molecular Weight 319.32 g/mol
SMILES O=C(O)C1=CC(C(O)=O)=CC(C2=CC=C(C=C2)C3=CC=NC=C3)=C1
InChIKey ZCPSJVXVYUXFHI-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0) typically synthesized?

4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid can be synthesized via the condensation of 2,5-biphen...

Compound Q&A

What industries use 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0)?

4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid (CAS: 2022152-71-0)?

When handling 4'-(4-Pyridinyl)-3,5-biphenyldicarboxylic acid, it is essential to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...