Compound Q&A

How is Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate (CAS: 146118-22-1) typically synthesized?

Answer

Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate
Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate is typically synthesized through a multi-step process involving the condensation of a benzylamine with a pyrrolidone derivative. The reaction involves the use of a base catalyst such as potassium carbonate and is carried out in an organic solvent like dimethylformamide (DMF). The overall yield and selectivity of the reaction can be enhanced by optimizing reaction conditions such as temperature and time.

About

English Name Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate
Molecular Formula C20H18N2O6
Molecular Weight 382.37 g/mol
SMILES C1CC(=O)N(C1=O)OC(=O)C(C2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3
InChIKey MZJSWDYNUOPUKB-SFHVURJKSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate (CAS: 146118-22-1)?

Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate is a crystalline compou...

Compound Q&A

What industries use Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate (CAS: 146118-22-1)?

Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate is primarily used in th...

Compound Q&A

What precautions should be taken when handling Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate (CAS: 146118-22-1)?

When handling Benzyl {(1S)-2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxo-1-phenylethyl}carbamate, it is im...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...