Compound Q&A

What industries use Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9)?

Answer

Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate]
Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9) finds applications in various industries. It is primarily used in the pharmaceutical industry as a chelating agent and in the synthesis of other organic compounds. It also has potential uses in the polymer industry for catalysis and in the development of new materials. Additionally, its reactivity makes it useful in the semiconductor industry for certain processing steps.

About

CAS No 83918-60-9
English Name Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate]
Molecular Formula C12H14MgO8
Molecular Weight 310.54 g/mol
SMILES CCOC(=O)C=CC(=O)[O-].CCOC(=O)C=CC(=O)[O-].[Mg+2]
InChIKey ZHLRSUSHKGQBNV-SYWGCQIGSA-L
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9)?

Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9) is a crystalline compound with a mo...

Compound Q&A

How is Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9) typically synthesized?

Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] is typically synthesized by reacting magnesium acetat...

Compound Q&A

What precautions should be taken when handling Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9)?

When handling Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9), it is important to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...