Compound Q&A

How is Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9) typically synthesized?

Answer

Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate]
Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] is typically synthesized by reacting magnesium acetate with (2E)-4-ethoxy-4-oxo-2-butenoic acid under mild conditions. The reaction involves the formation of a complex between magnesium and the carboxylate groups of the acid, followed by the removal of water and ethanol as by-products. The yield and selectivity are generally good under these conditions.

About

CAS No 83918-60-9
English Name Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate]
Molecular Formula C12H14MgO8
Molecular Weight 310.54 g/mol
SMILES CCOC(=O)C=CC(=O)[O-].CCOC(=O)C=CC(=O)[O-].[Mg+2]
InChIKey ZHLRSUSHKGQBNV-SYWGCQIGSA-L
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9)?

Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9) is a crystalline compound with a mo...

Compound Q&A

What industries use Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9)?

Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9) finds applications in various indus...

Compound Q&A

What precautions should be taken when handling Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9)?

When handling Magnesium bis[(2E)-4-ethoxy-4-oxo-2-butenoate] (CAS: 83918-60-9), it is important to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...