Compound Q&A

What industries use 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2)?

Answer

3-(1H-Pyrrol-1-yl)benzoic acid
3-(1H-Pyrrol-1-yl)benzoic acid finds application in pharmaceuticals, where it can be used as a precursor in the synthesis of drug molecules. It is also used in the production of certain sensors and in some polymer formulations due to its ability to form stable esters and amides.

About

CAS No 61471-45-2
English Name 3-(1H-Pyrrol-1-yl)benzoic acid
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
SMILES O=C(O)C1=CC=CC(N2C=CC=C2)=C1
InChIKey PODFNQCZFHLJPH-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2)?

3-(1H-Pyrrol-1-yl)benzoic acid is a white crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2) typically synthesized?

3-(1H-Pyrrol-1-yl)benzoic acid can be synthesized by reacting 1-benzoylpyrrole with a base such as s...

Compound Q&A

What precautions should be taken when handling 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2)?

When handling 3-(1H-Pyrrol-1-yl)benzoic acid, it is important to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...