Compound Q&A

What are the physical and chemical properties of 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2)?

Answer

3-(1H-Pyrrol-1-yl)benzoic acid
3-(1H-Pyrrol-1-yl)benzoic acid is a white crystalline solid with a molecular weight of approximately 191.17 g/mol. It is slightly soluble in water and has good solubility in organic solvents such as ethanol and acetone. Chemically, it is an aromatic carboxylic acid and shows moderate reactivity, particularly in esterification and amide formation reactions.

About

CAS No 61471-45-2
English Name 3-(1H-Pyrrol-1-yl)benzoic acid
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
SMILES O=C(O)C1=CC=CC(N2C=CC=C2)=C1
InChIKey PODFNQCZFHLJPH-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2) typically synthesized?

3-(1H-Pyrrol-1-yl)benzoic acid can be synthesized by reacting 1-benzoylpyrrole with a base such as s...

Compound Q&A

What industries use 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2)?

3-(1H-Pyrrol-1-yl)benzoic acid finds application in pharmaceuticals, where it can be used as a precu...

Compound Q&A

What precautions should be taken when handling 3-(1H-Pyrrol-1-yl)benzoic acid (CAS: 61471-45-2)?

When handling 3-(1H-Pyrrol-1-yl)benzoic acid, it is important to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...