Compound Q&A

What industries use Ethyl [(4-fluorophenyl)amino](oxo)acetate (CAS: 69065-91-4)?

Answer

Ethyl [(4-fluorophenyl)amino](oxo)acetate
Ethyl [(4-fluorophenyl)amino](oxo)acetate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also of interest in polymer science where it can be used as a monomer. Additionally, it has applications in the production of sensors and other electronic components due to its chemical functionality.

About

CAS No 69065-91-4
English Name Ethyl [(4-fluorophenyl)amino](oxo)acetate
Molecular Formula C10H10FNO3
Molecular Weight 211.19 g/mol
SMILES CCOC(=O)C(=O)NC1=CC=C(C=C1)F
InChIKey OUBZLXSQKQMFAH-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl [(4-fluorophenyl)amino](oxo)acetate (CAS: 69065-91-4)?

Ethyl [(4-fluorophenyl)amino](oxo)acetate is a white to off-white solid with a molecular weight of a...

Compound Q&A

How is Ethyl [(4-fluorophenyl)amino](oxo)acetate (CAS: 69065-91-4) typically synthesized?

Ethyl [(4-fluorophenyl)amino](oxo)acetate is typically synthesized via a multi-step process involvin...

Compound Q&A

What precautions should be taken when handling Ethyl [(4-fluorophenyl)amino](oxo)acetate (CAS: 69065-91-4)?

When handling Ethyl [(4-fluorophenyl)amino](oxo)acetate, it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...