Compound Q&A

What industries use TPT-NH2 (CAS: 22065-34-5)?

Answer

TPT-NH2
TPT-NH2 (CAS: 22065-34-5) is used in various industries due to its unique properties. It is employed in the pharmaceutical industry for the synthesis of novel drugs, in the semiconductor industry as a protective layer, and in polymer applications for its thermal stability. Additionally, it is utilized in the development of sensors and as a stabilizing agent in organic synthesis.

About

CAS No 22065-34-5
English Name TPT-NH2
Molecular Formula C21H18N6O3
Molecular Weight 402.41 g/mol
SMILES NC1=CC=C(OC2=NC(OC3=CC=C(C=C3)N)=NC(OC4=CC=C(C=C4)N)=N2)C=C1
InChIKey GGWRKPJRGMCLQA-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of TPT-NH2 (CAS: 22065-34-5)?

TPT-NH2 (CAS: 22065-34-5) is a solid with a crystalline form. Its molecular weight is approximately ...

Compound Q&A

How is TPT-NH2 (CAS: 22065-34-5) typically synthesized?

TPT-NH2 (CAS: 22065-34-5) is typically synthesized via a multistep process starting from TPT (2,5-di...

Compound Q&A

What precautions should be taken when handling TPT-NH2 (CAS: 22065-34-5)?

When handling TPT-NH2 (CAS: 22065-34-5), it is crucial to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...