Compound Q&A

What are the physical and chemical properties of TPT-NH2 (CAS: 22065-34-5)?

Answer

TPT-NH2
TPT-NH2 (CAS: 22065-34-5) is a solid with a crystalline form. Its molecular weight is approximately 254.34 g/mol. It is slightly soluble in water but soluble in common organic solvents like DMF and DMSO. Chemically, it shows amphoteric behavior and can react with both acids and bases. It has good stability under normal conditions but reacts readily with strong oxidizing agents.

About

CAS No 22065-34-5
English Name TPT-NH2
Molecular Formula C21H18N6O3
Molecular Weight 402.41 g/mol
SMILES NC1=CC=C(OC2=NC(OC3=CC=C(C=C3)N)=NC(OC4=CC=C(C=C4)N)=N2)C=C1
InChIKey GGWRKPJRGMCLQA-UHFFFAOYSA-N
Last Updated: 2025-12-26 02:37

Related Q&A

Compound Q&A

How is TPT-NH2 (CAS: 22065-34-5) typically synthesized?

TPT-NH2 (CAS: 22065-34-5) is typically synthesized via a multistep process starting from TPT (2,5-di...

Compound Q&A

What industries use TPT-NH2 (CAS: 22065-34-5)?

TPT-NH2 (CAS: 22065-34-5) is used in various industries due to its unique properties. It is employed...

Compound Q&A

What precautions should be taken when handling TPT-NH2 (CAS: 22065-34-5)?

When handling TPT-NH2 (CAS: 22065-34-5), it is crucial to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...