Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate (CAS: 1352999-04-2)?

Answer

2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate
When handling 2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, it should be cleaned up immediately using a suitable absorbent material. Always refer to the safety data sheet (SDS) for detailed handling and storage instructions.

About

English Name 2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate
Molecular Formula C12H24N2O2
Molecular Weight 228.34 g/mol
SMILES CC(C)(C)OC(=O)NCC1(N)CCCCC1
InChIKey CMEHRZGJNHKUAN-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate (CAS: 1352999-04-2)?

2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate is a colorless or pale yellow liquid with a...

Compound Q&A

How is 2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate (CAS: 1352999-04-2) typically synthesized?

2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate can be synthesized via a multi-step process...

Compound Q&A

What industries use 2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate (CAS: 1352999-04-2)?

2-Methyl-2-propanyl [(1-aminocyclohexyl)methyl]carbamate is primarily used in the pharmaceutical ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...