Compound Q&A

What industries use 3-Iodo-L-Phenylalanine (CAS: 20846-39-3)?

Answer

3-Iodo-L-Phenylalanine
3-Iodo-L-Phenylalanine is primarily used in the pharmaceutical industry for its potential in drug development, particularly in the modification of peptides and proteins. It may also have applications in the polymer industry for introducing functional groups in polymer synthesis. Its unique structure makes it useful in the development of new materials and sensors due to its chemical reactivity.

About

CAS No 20846-39-3
English Name 3-Iodo-L-Phenylalanine
Molecular Formula C9H10INO2
Molecular Weight 291.088 g/mol
SMILES C1=CC(=CC(=C1)I)CC(C(=O)O)N
InChIKey BABTYIKKTLTNRX-QMMMGPOBSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Iodo-L-Phenylalanine (CAS: 20846-39-3)?

3-Iodo-L-Phenylalanine is a solid with a crystalline form. Its molecular weight is approximately 281...

Compound Q&A

How is 3-Iodo-L-Phenylalanine (CAS: 20846-39-3) typically synthesized?

3-Iodo-L-Phenylalanine is typically synthesized via the iodination of L-Phenylalanine using N-chloro...

Compound Q&A

What precautions should be taken when handling 3-Iodo-L-Phenylalanine (CAS: 20846-39-3)?

When handling 3-Iodo-L-Phenylalanine, it is important to use personal protective equipment (PPE) suc...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA