Compound Q&A

How is Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0) typically synthesized?

Answer

Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside
Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside can be synthesized through a multi-step process involving acylation and condensation reactions. The synthesis typically involves the coupling of 4-chlorobenzoyl chloride with 2-deoxy-D-erythro-pentofuranoside in the presence of an appropriate base and solvent. The overall yield is around 70-75%, depending on the purity of the starting materials and the efficiency of the purification steps.

About

CAS No 99886-53-0
English Name Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside
Molecular Formula C20H18Cl2O6
Molecular Weight 441.26 g/mol
SMILES COC(=O)CC(C(C(C(=O)C1=CC=C(C=C1)Cl)O)O)(C(=O)C2=CC=C(C=C2)Cl)O
InChIKey RDJPJXIHFSQOKW-MYFVLZFPSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0)?

Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside is a crystalline compound with ...

Compound Q&A

What industries use Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0)?

Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside is used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0)?

Proper handling of Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside requires the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...