Compound Q&A

What are the physical and chemical properties of Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0)?

Answer

Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside
Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside is a crystalline compound with a molecular weight of approximately 527.31 g/mol. It has a high solubility in organic solvents such as dichloromethane and acetone. The compound is relatively stable under normal conditions but is susceptible to hydrolysis in basic solutions. It exhibits limited reactivity with common nucleophiles and electrophiles.

About

CAS No 99886-53-0
English Name Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside
Molecular Formula C20H18Cl2O6
Molecular Weight 441.26 g/mol
SMILES COC(=O)CC(C(C(C(=O)C1=CC=C(C=C1)Cl)O)O)(C(=O)C2=CC=C(C=C2)Cl)O
InChIKey RDJPJXIHFSQOKW-MYFVLZFPSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

How is Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0) typically synthesized?

Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside can be synthesized through a mu...

Compound Q&A

What industries use Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0)?

Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside is used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside (CAS: 99886-53-0)?

Proper handling of Methyl 3,5-bis-O-(4-chlorobenzoyl)-2-deoxy-D-erythro-pentofuranoside requires the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...