Compound Q&A

What industries use Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5)?

Answer

Pregn-4-ene-3,6,20-trione
Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5) is primarily used in the pharmaceutical industry for the synthesis of progestogens, which are important hormones in birth control and other medical applications. It also finds use in polymer chemistry for the development of novel materials with specific properties. Additionally, this compound can be used in the production of chemical sensors and as a precursor in semiconductor manufacturing processes.

About

CAS No 2243-08-5
English Name Pregn-4-ene-3,6,20-trione
Molecular Formula C21H28O3
Molecular Weight 328.45 g/mol
SMILES CC(=O)C1CCC2C1(CCC3C2CC(=O)C4=CC(=O)CCC34C)C
InChIKey LASCNIPXMJNRGS-HGUQNLGYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5)?

Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5) is a cyclic ketone with a molecular weight of approximate...

Compound Q&A

How is Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5) typically synthesized?

Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5) can be synthesized via a variety of methods, including Wi...

Compound Q&A

What precautions should be taken when handling Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5)?

When handling Pregn-4-ene-3,6,20-trione (CAS: 2243-08-5), appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...