Compound Q&A

How is 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0) typically synthesized?

Answer

2-Bromo-9,9-difluoro-7-iodo-9H-fluorene
2-Bromo-9,9-difluoro-7-iodo-9H-fluorene is typically synthesized via a multistep process involving fluorination of 9,9-difluoro-7-hydroxy-9H-fluorene followed by bromination and iodination. This process often requires the use of Lewis acids and mild redox conditions to ensure high selectivity and yield.

About

English Name 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene
Molecular Formula C13H6BrF2I
Molecular Weight 406.99 g/mol
SMILES Brc1ccc2c(c1)C(F)(F)c1c2ccc(c1)I
InChIKey DKSYLEFLMUQPDJ-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0)?

2-Bromo-9,9-difluoro-7-iodo-9H-fluorene is a crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0)?

2-Bromo-9,9-difluoro-7-iodo-9H-fluorene is used in the pharmaceutical and semiconductor industries f...

Compound Q&A

What precautions should be taken when handling 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0)?

When handling 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene, it is essential to use personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...