Compound Q&A

What are the physical and chemical properties of 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0)?

Answer

2-Bromo-9,9-difluoro-7-iodo-9H-fluorene
2-Bromo-9,9-difluoro-7-iodo-9H-fluorene is a crystalline solid with a molecular weight of approximately 532.16 g/mol. It has low solubility in common organic solvents but good solubility in polar aprotic solvents. This compound is highly reactive, especially towards nucleophiles due to the presence of the bromo, difluoro, and iodine substituents.

About

English Name 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene
Molecular Formula C13H6BrF2I
Molecular Weight 406.99 g/mol
SMILES Brc1ccc2c(c1)C(F)(F)c1c2ccc(c1)I
InChIKey DKSYLEFLMUQPDJ-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

How is 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0) typically synthesized?

2-Bromo-9,9-difluoro-7-iodo-9H-fluorene is typically synthesized via a multistep process involving f...

Compound Q&A

What industries use 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0)?

2-Bromo-9,9-difluoro-7-iodo-9H-fluorene is used in the pharmaceutical and semiconductor industries f...

Compound Q&A

What precautions should be taken when handling 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene (CAS: 1499193-60-0)?

When handling 2-Bromo-9,9-difluoro-7-iodo-9H-fluorene, it is essential to use personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...