Compound Q&A

What are the physical and chemical properties of 2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine (CAS: 448964-37-2)?

Answer

2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine
2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine is a crystalline solid with a molecular weight of approximately 243.31 g/mol. It has a moderate solubility in organic solvents like ethanol and acetone but is poorly soluble in water. Chemically, it exhibits basic properties due to the amine group and is generally stable under normal conditions but reactive towards strong acids and bases. It has a melting point of around 100-102°C and a boiling point of about 255-257°C.

About

English Name 2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine
Molecular Formula C13H17NO
Molecular Weight 203.28 g/mol
SMILES C1CC2=C(C1CCN)C3=C(C=C2)OCC3
InChIKey BFNUHWYOQCGTCA-UHFFFAOYSA-N
Last Updated: 2025-12-25 22:28

Related Q&A

Compound Q&A

How is 2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine (CAS: 448964-37-2) typically synthesized?

2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine can be synthesized via a multistep process i...

Compound Q&A

What industries use 2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine (CAS: 448964-37-2)?

2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine finds applications in various industries, in...

Compound Q&A

What precautions should be taken when handling 2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine (CAS: 448964-37-2)?

When handling 2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-ylethylamine, it is important to use approp...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...