Compound Q&A

What precautions should be taken when handling N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0)?

Answer

N-(3-Nitrophenyl)propionamide
When handling N-(3-Nitrophenyl)propionamide, it is essential to use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and laboratory coat. Work in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up carefully using appropriate materials, and the substance should be disposed of according to local regulations and SDS guidelines.

About

CAS No 7470-50-0
English Name N-(3-Nitrophenyl)propionamide
Molecular Formula C9H10N2O3
Molecular Weight 194.19 g/mol
SMILES CCC(=O)NC1=CC(=CC=C1)[N+](=O)[O-]
InChIKey KJYLJFHUBHZCKT-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0)?

N-(3-Nitrophenyl)propionamide is a crystalline solid with a molecular weight of approximately 211.13...

Compound Q&A

How is N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0) typically synthesized?

N-(3-Nitrophenyl)propionamide is typically synthesized by the reaction of 3-nitrophenol with propion...

Compound Q&A

What industries use N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0)?

N-(3-Nitrophenyl)propionamide is used in various industries, particularly in pharmaceuticals for the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...