Compound Q&A

How is N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0) typically synthesized?

Answer

N-(3-Nitrophenyl)propionamide
N-(3-Nitrophenyl)propionamide is typically synthesized by the reaction of 3-nitrophenol with propionamide. This process usually involves the use of a solvent, such as methanol, and is carried out under acidic conditions. The yield is generally around 80-85%, and the reaction is selective, producing the desired product with high purity.

About

CAS No 7470-50-0
English Name N-(3-Nitrophenyl)propionamide
Molecular Formula C9H10N2O3
Molecular Weight 194.19 g/mol
SMILES CCC(=O)NC1=CC(=CC=C1)[N+](=O)[O-]
InChIKey KJYLJFHUBHZCKT-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0)?

N-(3-Nitrophenyl)propionamide is a crystalline solid with a molecular weight of approximately 211.13...

Compound Q&A

What industries use N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0)?

N-(3-Nitrophenyl)propionamide is used in various industries, particularly in pharmaceuticals for the...

Compound Q&A

What precautions should be taken when handling N-(3-Nitrophenyl)propionamide (CAS: 7470-50-0)?

When handling N-(3-Nitrophenyl)propionamide, it is essential to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...