Compound Q&A

How is (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) typically synthesized?

Answer

(2-Hydroxybenzyl)(triphenyl)phosphonium bromide
(2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) is synthesized through a multistep process involving the reaction of 2-hydroxybenzyl chloride with triphenylphosphine in the presence of a suitable base such as triethylamine. This synthesis typically yields a product with a high degree of purity and a yield of around 80-85%. The reaction is carried out at room temperature and under anhydrous conditions to ensure optimal product quality.

About

CAS No 70340-04-4
English Name (2-Hydroxybenzyl)(triphenyl)phosphonium bromide
Molecular Formula C25H22BrOP
Molecular Weight 449.3 g/mol
SMILES C1=CC=C(C=C1)[P+](CC2=CC=CC=C2O)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-]
InChIKey FKKZGQXMWVGPMH-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4)?

(2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) is a crystalline compound with a m...

Compound Q&A

What industries use (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4)?

(2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) finds application in various indus...

Compound Q&A

What precautions should be taken when handling (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4)?

When handling (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...