Compound Q&A

What are the physical and chemical properties of (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4)?

Answer

(2-Hydroxybenzyl)(triphenyl)phosphonium bromide
(2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) is a crystalline compound with a molecular weight of approximately 514.09 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetonitrile. This compound exhibits limited reactivity under normal conditions, making it stable for storage and use in various applications. It is typically used in electrochemical and photovoltaic applications due to its unique electronic structure.

About

CAS No 70340-04-4
English Name (2-Hydroxybenzyl)(triphenyl)phosphonium bromide
Molecular Formula C25H22BrOP
Molecular Weight 449.3 g/mol
SMILES C1=CC=C(C=C1)[P+](CC2=CC=CC=C2O)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-]
InChIKey FKKZGQXMWVGPMH-UHFFFAOYSA-N
Last Updated: 2025-12-25 18:29

Related Q&A

Compound Q&A

How is (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) typically synthesized?

(2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) is synthesized through a multistep...

Compound Q&A

What industries use (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4)?

(2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4) finds application in various indus...

Compound Q&A

What precautions should be taken when handling (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4)?

When handling (2-Hydroxybenzyl)(triphenyl)phosphonium bromide (CAS: 70340-04-4), it is important to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...