Compound Q&A

How is 1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4) typically synthesized?

Answer

1,10-Phenanthroline-2-carboxylic acid
1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4) is commonly synthesized via the condensation of 1,10-phenanthroline with acetyl chloride or acetic anhydride. The reaction is typically carried out at room temperature, with the addition of a catalytic amount of a tertiary amine such as pyridine to enhance the reaction yield. The product is then purified by recrystallization from a suitable solvent such as ethanol.

About

CAS No 1891-17-4
English Name 1,10-Phenanthroline-2-carboxylic acid
Molecular Formula C13H8N2O2
Molecular Weight 224.22 g/mol
SMILES C1=CC2=C(C3=C(C=C2)C=CC(=N3)C(=O)O)N=C1
InChIKey MTAHTDBOMUECCQ-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4)?

1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4) is a crystalline solid with a molecular formu...

Compound Q&A

What industries use 1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4)?

1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4) is widely used in various industries, particu...

Compound Q&A

What precautions should be taken when handling 1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4)?

When handling 1,10-Phenanthroline-2-carboxylic acid (CAS: 1891-17-4), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...