Compound Q&A

How is 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) typically synthesized?

Answer

4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate
4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) is synthesized through the esterification of 4-(octyloxy)benzoic acid and 4-[(2S)-2-methylbutyl]phenol. The reaction is catalyzed by a transition metal such as iron or zinc, and the yield is typically around 85%. The process requires careful control of reaction temperature and time to ensure high selectivity and yield.

About

CAS No 69777-61-3
English Name 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate
Molecular Formula C26H36O3
Molecular Weight 396.57 g/mol
SMILES CCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(cc2)C[C@@H](C)CC
InChIKey XSEXHHROOVDZBQ-NRFANRHFSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3)?

4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) is a crystalline compound with a...

Compound Q&A

What industries use 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3)?

4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3)?

When handling 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...