Compound Q&A

What are the physical and chemical properties of 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3)?

Answer

4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate
4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) is a crystalline compound with a molecular weight of approximately 362.47 g/mol. It has a moderate solubility in organic solvents such as ethanol and dichloromethane. Chemically, it is relatively stable but can react with strong bases. It has limited reactivity with common organic reagents and exhibits good thermal stability.

About

CAS No 69777-61-3
English Name 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate
Molecular Formula C26H36O3
Molecular Weight 396.57 g/mol
SMILES CCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(cc2)C[C@@H](C)CC
InChIKey XSEXHHROOVDZBQ-NRFANRHFSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) typically synthesized?

4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) is synthesized through the ester...

Compound Q&A

What industries use 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3)?

4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3)?

When handling 4-[(2S)-2-Methylbutyl]phenyl 4-(octyloxy)benzoate (CAS: 69777-61-3), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...