Compound Q&A

What industries use N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

Answer

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine
N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is used in the pharmaceutical and polymer industries. It serves as a precursor for synthesizing other compounds with specific biological activities and is also used in the development of new materials with unique properties. Additionally, it has applications in the sensor and semiconductor industries due to its electronic properties.

About

English Name N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine
Molecular Formula C20H16Cl2N4
Molecular Weight 383.28200000000004 g/mol
SMILES c1cc2c(ccnc2cc1Cl)NCCNc3ccnc4c3ccc(c4)Cl
InChIKey SSXYXSMMVMVYEV-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is a crystalline solid with a m...

Compound Q&A

How is N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) typically synthesized?

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is synthesized by the condensat...

Compound Q&A

What precautions should be taken when handling N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

When handling N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6), it is important ...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...