Compound Q&A

What are the physical and chemical properties of N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

Answer

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine
N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is a crystalline solid with a molecular weight of approximately 340.2 g/mol. It has a limited solubility in water and is more soluble in organic solvents like DMF and DMSO. This compound is relatively stable, but it reacts with strong bases and acids under certain conditions. It is typically used in the synthesis of other compounds and as a precursor in organic chemistry.

About

English Name N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine
Molecular Formula C20H16Cl2N4
Molecular Weight 383.28200000000004 g/mol
SMILES c1cc2c(ccnc2cc1Cl)NCCNc3ccnc4c3ccc(c4)Cl
InChIKey SSXYXSMMVMVYEV-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) typically synthesized?

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is synthesized by the condensat...

Compound Q&A

What industries use N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is used in the pharmaceutical a...

Compound Q&A

What precautions should be taken when handling N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

When handling N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6), it is important ...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...