Compound Q&A

How is N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) typically synthesized?

Answer

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine
N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is synthesized by the condensation of 7-chloro-4-quinolinecarboxaldehyde with ethylenediamine. The reaction is typically carried out under mild conditions using ethanol as the solvent, with a yield ranging from 70% to 80%. The reaction requires careful control of temperature and pH to ensure the desired product is formed.

About

English Name N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine
Molecular Formula C20H16Cl2N4
Molecular Weight 383.28200000000004 g/mol
SMILES c1cc2c(ccnc2cc1Cl)NCCNc3ccnc4c3ccc(c4)Cl
InChIKey SSXYXSMMVMVYEV-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is a crystalline solid with a m...

Compound Q&A

What industries use N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6) is used in the pharmaceutical a...

Compound Q&A

What precautions should be taken when handling N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6)?

When handling N,N'-Bis(7-chloro-4-quinolinyl)-1,2-ethanediamine (CAS: 140926-75-6), it is important ...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...