Compound Q&A

What precautions should be taken when handling 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7)?

Answer

1-Naphthyl trifluoromethanesulfonate
When handling 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The reaction should be conducted in a well-ventilated fume hood to minimize exposure to trifluoromethanesulfonic acid. Spills should be handled according to the safety data sheet (SDS) guidelines, and the compound should be stored under appropriate conditions, preferably in a desiccator to prevent moisture absorption.

About

CAS No 99747-74-7
English Name 1-Naphthyl trifluoromethanesulfonate
Molecular Formula C11H7F3O3S
Molecular Weight 276.24 g/mol
SMILES C1=CC=C2C(=C1)C=CC=C2OS(=O)(=O)C(F)(F)F
InChIKey WQWUQDVFRYMMCY-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7)?

1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) typically synthesized?

1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) is typically synthesized by the trifluorometh...

Compound Q&A

What industries use 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7)?

1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) is used in various industries, including phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...