Compound Q&A

How is 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) typically synthesized?

Answer

1-Naphthyl trifluoromethanesulfonate
1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) is typically synthesized by the trifluoromethanesulfonation of 1-naphthol using triflic anhydride as the sulfonating agent. The reaction is performed under anhydrous conditions and requires the use of a phase-transfer catalyst to improve the reaction selectivity and yield.

About

CAS No 99747-74-7
English Name 1-Naphthyl trifluoromethanesulfonate
Molecular Formula C11H7F3O3S
Molecular Weight 276.24 g/mol
SMILES C1=CC=C2C(=C1)C=CC=C2OS(=O)(=O)C(F)(F)F
InChIKey WQWUQDVFRYMMCY-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7)?

1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7)?

1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7) is used in various industries, including phar...

Compound Q&A

What precautions should be taken when handling 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7)?

When handling 1-Naphthyl trifluoromethanesulfonate (CAS: 99747-74-7), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...