Compound Q&A

How is (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8) typically synthesized?

Answer

(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine
(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine is synthesized through a multistep process involving the coupling of 1,1'-binaphthyl with methanol in the presence of a suitable coupling reagent such as EDCI and DMAP. The reaction yields a mixture of diastereomers, which can be separated using column chromatography. Further derivatization can be achieved via alkylation or acylation reactions.

About

CAS No 93621-64-8
English Name (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine
Molecular Formula C22H20N2
Molecular Weight 312.42 g/mol
SMILES CNC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)NC
InChIKey PXDKDUXMEHPNCO-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8)?

(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8)?

(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine is primarily used in pharmaceuticals, where it serves as a ...

Compound Q&A

What precautions should be taken when handling (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8)?

When handling (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine, it is essential to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...