Compound Q&A

What are the physical and chemical properties of (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8)?

Answer

(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine
(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine is a white crystalline solid with a molecular weight of approximately 404.4 g/mol. It has a high solubility in organic solvents such as dichloromethane and ethyl acetate, and is poorly soluble in water. This compound exhibits good stability under normal conditions but can react with strong acids and bases. It is commonly used in chiral catalysis and as a ligand in organometallic chemistry.

About

CAS No 93621-64-8
English Name (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine
Molecular Formula C22H20N2
Molecular Weight 312.42 g/mol
SMILES CNC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)NC
InChIKey PXDKDUXMEHPNCO-UHFFFAOYSA-N
Last Updated: 2025-12-25 13:43

Related Q&A

Compound Q&A

How is (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8) typically synthesized?

(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine is synthesized through a multistep process involving the co...

Compound Q&A

What industries use (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8)?

(S)-N,N'-Dimethyl-1,1'-binaphthyldiamine is primarily used in pharmaceuticals, where it serves as a ...

Compound Q&A

What precautions should be taken when handling (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine (CAS: 93621-64-8)?

When handling (S)-N,N'-Dimethyl-1,1'-binaphthyldiamine, it is essential to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...