Compound Q&A

What industries use 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8)?

Answer

2-(Diphenylmethyl)piperidine hydrochloride (1:1)
2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8) is widely used in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in the polymer industry as a stabilizer and in the semiconductor industry as a dopant. Additionally, it is used in sensor technology for its unique chemical properties.

About

CAS No 5807-81-8
English Name 2-(Diphenylmethyl)piperidine hydrochloride (1:1)
Molecular Formula C18H22ClN
Molecular Weight 287.83 g/mol
SMILES C1CCNC(C1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl
InChIKey NTADPDIPKMRRQV-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8)?

2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8) is a crystalline compound with a molecul...

Compound Q&A

How is 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8) typically synthesized?

2-(Diphenylmethyl)piperidine hydrochloride is typically synthesized by reacting diphenylmethylpiperi...

Compound Q&A

What precautions should be taken when handling 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8)?

When handling 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...