Compound Q&A

What are the physical and chemical properties of 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8)?

Answer

2-(Diphenylmethyl)piperidine hydrochloride (1:1)
2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8) is a crystalline compound with a molecular weight of approximately 362.37 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is known for its high stability and low reactivity under normal conditions. It is a commonly used intermediate in organic synthesis and pharmaceuticals.

About

CAS No 5807-81-8
English Name 2-(Diphenylmethyl)piperidine hydrochloride (1:1)
Molecular Formula C18H22ClN
Molecular Weight 287.83 g/mol
SMILES C1CCNC(C1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl
InChIKey NTADPDIPKMRRQV-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8) typically synthesized?

2-(Diphenylmethyl)piperidine hydrochloride is typically synthesized by reacting diphenylmethylpiperi...

Compound Q&A

What industries use 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8)?

2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8) is widely used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8)?

When handling 2-(Diphenylmethyl)piperidine hydrochloride (CAS: 5807-81-8), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...