Compound Q&A

What are the physical and chemical properties of (5Z)-7-(3,5-Dihydroxy-2-{(1E)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl}cyclopentyl)-5-heptenoic acid (CAS: 54276-17-4)?

Answer

(5Z)-7-(3,5-Dihydroxy-2-{(1E)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl}cyclopentyl)-5-heptenoic acid
This compound is a colorless solid with a molecular weight of approximately 457.35 g/mol. It has a low solubility in water and is more soluble in organic solvents. It is reactive towards bases and can undergo hydrolysis under basic conditions. It is stable under acidic conditions and requires storage in a dry, cool place.

About

CAS No 54276-17-4
English Name (5Z)-7-(3,5-Dihydroxy-2-{(1E)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl}cyclopentyl)-5-heptenoic acid
Molecular Formula C23H29F3O6
Molecular Weight 458.47 g/mol
SMILES O=C(O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COC2=CC=CC(C(F)(F)F)=C2)[C@H](O)C[C@@H]1O
InChIKey WWSWYXNVCBLWNZ-MTECWQMOSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is (5Z)-7-(3,5-Dihydroxy-2-{(1E)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl}cyclopentyl)-5-heptenoic acid (CAS: 54276-17-4) typically synthesized?

This compound is synthesized through a multistep process involving functional group manipulations an...

Compound Q&A

What industries use (5Z)-7-(3,5-Dihydroxy-2-{(1E)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]-1-buten-1-yl}cyclopentyl)-5-heptenoic acid (CAS: 54276-17-4)?

This compound is primarily used in the pharmaceutical industry for developing new drugs due to its u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...