Compound Q&A

What industries use 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2)?

Answer

1-(Isocyanomethyl)-1H-benzotriazole
1-(Isocyanomethyl)-1H-benzotriazole is widely utilized in pharmaceuticals, where it serves as a protecting group in synthetic chemistry. It is also used in the production of polymers for their enhanced stability and in the development of sensors and semiconductors due to its reactive isocyanate moiety.

About

CAS No 87022-42-2
English Name 1-(Isocyanomethyl)-1H-benzotriazole
Molecular Formula C8H6N4
Molecular Weight 12.01 g/mol
SMILES [C-]#[N+]CN1C2=CC=CC=C2N=N1
InChIKey YZTNZXMSOPEFKC-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2)?

1-(Isocyanomethyl)-1H-benzotriazole is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2) typically synthesized?

1-(Isocyanomethyl)-1H-benzotriazole is commonly synthesized through the reaction of 1-aminobenzotria...

Compound Q&A

What precautions should be taken when handling 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2)?

Handling 1-(Isocyanomethyl)-1H-benzotriazole requires strict safety measures due to its isocyanate f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...