Compound Q&A

How is 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2) typically synthesized?

Answer

1-(Isocyanomethyl)-1H-benzotriazole
1-(Isocyanomethyl)-1H-benzotriazole is commonly synthesized through the reaction of 1-aminobenzotriazole with carbon dioxide in the presence of a catalyst. The process involves aminolysis under basic conditions, yielding the desired isocyanate derivative. The method provides high selectivity and yield, making it a reliable route for industrial production.

About

CAS No 87022-42-2
English Name 1-(Isocyanomethyl)-1H-benzotriazole
Molecular Formula C8H6N4
Molecular Weight 12.01 g/mol
SMILES [C-]#[N+]CN1C2=CC=CC=C2N=N1
InChIKey YZTNZXMSOPEFKC-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2)?

1-(Isocyanomethyl)-1H-benzotriazole is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2)?

1-(Isocyanomethyl)-1H-benzotriazole is widely utilized in pharmaceuticals, where it serves as a prot...

Compound Q&A

What precautions should be taken when handling 1-(Isocyanomethyl)-1H-benzotriazole (CAS: 87022-42-2)?

Handling 1-(Isocyanomethyl)-1H-benzotriazole requires strict safety measures due to its isocyanate f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...