Compound Q&A

How is 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) typically synthesized?

Answer

2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde
2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) is typically synthesized via the acetylation of m-cresol with acetic anhydride in the presence of a catalyst such as pyridine. The reaction proceeds under mild conditions, and the product is isolated by recrystallization. The synthetic route provides a yield of around 85%, and the product is highly selective for the desired aldehyde form.

About

English Name 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde
Molecular Formula C12H12O6
Molecular Weight 252.22 g/mol
SMILES COc1c(c(c(c(c1C=O)OC)C=O)OC)C=O
InChIKey PGHSMJSBERHVLW-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1)?

2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) is a white crystalline solid with a...

Compound Q&A

What industries use 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1)?

2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) is used in various industries due t...

Compound Q&A

What precautions should be taken when handling 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1)?

When handling 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1), it is essential to t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...