Compound Q&A

What are the physical and chemical properties of 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1)?

Answer

2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde
2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) is a white crystalline solid with a molecular weight of approximately 252.24 g/mol. It has a slight odor and is poorly soluble in water but soluble in organic solvents. The compound is known for its reactivity, particularly in its ability to undergo electrophilic aromatic substitution reactions. It is also stable under normal conditions but requires storage in a dry place to prevent moisture absorption.

About

English Name 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde
Molecular Formula C12H12O6
Molecular Weight 252.22 g/mol
SMILES COc1c(c(c(c(c1C=O)OC)C=O)OC)C=O
InChIKey PGHSMJSBERHVLW-UHFFFAOYSA-N
Last Updated: 2025-12-25 08:48

Related Q&A

Compound Q&A

How is 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) typically synthesized?

2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) is typically synthesized via the ac...

Compound Q&A

What industries use 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1)?

2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1) is used in various industries due t...

Compound Q&A

What precautions should be taken when handling 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1)?

When handling 2,4,6-Trimethoxy-1,3,5-benzenetricarbaldehyde (CAS: 680575-17-1), it is essential to t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...