Compound Q&A

What are the physical and chemical properties of Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1)?

Answer

Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate
Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1) is a crystalline solid with a molecular weight of approximately 326.24 g/mol. It has limited water solubility and is soluble in organic solvents like DMSO and DMF. This compound is known for its reactivity, particularly in nucleophilic substitution reactions. It can form stable salts and esters.

About

English Name Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate
Molecular Formula C13H11FN4O2
Molecular Weight 274.25 g/mol
SMILES CCOC(=O)c1nn(c(c1C#N)N)c1ccc(cc1)F
InChIKey UUTVXASIJAMACY-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1) typically synthesized?

Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1) is typically ...

Compound Q&A

What industries use Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1)?

Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1) is primarily ...

Compound Q&A

What precautions should be taken when handling Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1)?

When handling Ethyl 5-amino-4-cyano-1-(4-fluorophenyl)-1H-pyrazole-3-carboxylate (CAS: 1001665-65-1)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...