Compound Q&A

What precautions should be taken when handling HO-PEG16-OH (CAS: 6812-36-8)?

Answer

HO-PEG16-OH
When handling HO-PEG16-OH, it is recommended to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be cleaned up immediately using appropriate absorbent materials. In case of contact with eyes or skin, flush with copious amounts of water and seek medical advice. Refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 6812-36-8
English Name HO-PEG16-OH
Molecular Formula C32H66O17
Molecular Weight 722.86 g/mol
SMILES C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O
InChIKey DHORSBRLGKJPFC-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of HO-PEG16-OH (CAS: 6812-36-8)?

HO-PEG16-OH is a polyethylene glycol derivative with a molecular weight of approximately 2,500 g/mol...

Compound Q&A

How is HO-PEG16-OH (CAS: 6812-36-8) typically synthesized?

HO-PEG16-OH is typically synthesized through the reaction of 16-oxido-2-oxo-1,2-ethanediol with ethy...

Compound Q&A

What industries use HO-PEG16-OH (CAS: 6812-36-8)?

HO-PEG16-OH finds applications in pharmaceuticals, where it serves as a drug delivery carrier or pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...