Compound Q&A

How is 3-Acetamido-5-methoxybenzoic acid (CAS: 78238-03-6) typically synthesized?

Answer

3-Acetamido-5-methoxybenzoic acid
3-Acetamido-5-methoxybenzoic acid is typically synthesized via the acetylation of 5-methoxybenzoic acid followed by the amide coupling reaction. The synthesis involves the use of acetic anhydride and a suitable base such as pyridine. The yield is generally around 80-85%, and the reaction is carried out with good selectivity.

About

CAS No 78238-03-6
English Name 3-Acetamido-5-methoxybenzoic acid
Molecular Formula C10H11NO4
Molecular Weight 209.2 g/mol
SMILES CC(=O)NC1=CC(=CC(=C1)C(=O)O)OC
InChIKey CUTDJCLTOMWNGD-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Acetamido-5-methoxybenzoic acid (CAS: 78238-03-6)?

3-Acetamido-5-methoxybenzoic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 3-Acetamido-5-methoxybenzoic acid (CAS: 78238-03-6)?

3-Acetamido-5-methoxybenzoic acid is used in the pharmaceutical industry for the synthesis of certai...

Compound Q&A

What precautions should be taken when handling 3-Acetamido-5-methoxybenzoic acid (CAS: 78238-03-6)?

When handling 3-Acetamido-5-methoxybenzoic acid, it is important to use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...