Compound Q&A

How is (S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate (CAS: 868539-99-5) typically synthesized?

Answer

(S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
This compound is typically synthesized via a multi-step process involving amidation and esterification reactions. The key steps include the synthesis of the amino acid precursor, its coupling with the appropriate alcohol, and the final esterification with methyl trifluoroacetate. The reaction conditions and catalysts are optimized to achieve high yields and selectivity.

About

English Name (S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
Molecular Formula C28H36F3N3O6
Molecular Weight 567.6 g/mol
SMILES OC(=O)C(F)(F)F.COC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCc1ccccc1)N)CC(C)C)Cc1ccccc1
InChIKey LAPJYAIMBWUZSL-RGRVRPFLSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What industries use (S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate (CAS: 868539-99-5)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...