Compound Q&A

What are the physical and chemical properties of (S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate (CAS: 868539-99-5)?

Answer

(S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
This compound is a white crystalline solid with a molecular weight of approximately 671.6 g/mol. It has a high solubility in organic solvents like DMSO and poor solubility in water. Chemically, it is highly reactive, especially towards nucleophiles and bases. It is stable under normal conditions but requires storage under nitrogen to prevent oxidation.

About

English Name (S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
Molecular Formula C28H36F3N3O6
Molecular Weight 567.6 g/mol
SMILES OC(=O)C(F)(F)F.COC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCc1ccccc1)N)CC(C)C)Cc1ccccc1
InChIKey LAPJYAIMBWUZSL-RGRVRPFLSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is (S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate (CAS: 868539-99-5) typically synthesized?

This compound is typically synthesized via a multi-step process involving amidation and esterificati...

Compound Q&A

What industries use (S)-Methyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate (CAS: 868539-99-5)?

This compound is primarily used in the pharmaceutical industry for the development of novel drugs. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...