Compound Q&A

What industries use Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4)?

Answer

Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate
Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4) finds application in the pharmaceutical industry, where it is used as a precursor in the synthesis of certain medications. It is also utilized in the polymer industry for the synthesis of functional polymers and in the semiconductor industry for the development of novel materials. Additionally, it has potential uses in the sensor industry for developing chemical sensors.

About

English Name Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate
Molecular Formula C10H17F2NO4
Molecular Weight 253.24 g/mol
SMILES CCOC(=O)C(F)(F)CNC(=O)OC(C)(C)C
InChIKey LYQQVOPAOGCYKT-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4)?

Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4) is a c...

Compound Q&A

How is Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4) typically synthesized?

Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate can be synthesized via a ...

Compound Q&A

What precautions should be taken when handling Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4)?

When handling Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 84798...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...