Compound Q&A

How is Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4) typically synthesized?

Answer

Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate
Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate can be synthesized via a multi-step reaction sequence involving protective group chemistry and acylation. It typically involves the conversion of a primary alcohol to its corresponding acyl chloride, followed by the formation of the amino ester. The key catalysts used include acid anhydrides or acyl chlorides, and the process often requires mild to moderate heating. The overall yield can range from 50% to 70%.

About

English Name Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate
Molecular Formula C10H17F2NO4
Molecular Weight 253.24 g/mol
SMILES CCOC(=O)C(F)(F)CNC(=O)OC(C)(C)C
InChIKey LYQQVOPAOGCYKT-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4)?

Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4) is a c...

Compound Q&A

What industries use Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4)?

Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4) finds ...

Compound Q&A

What precautions should be taken when handling Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 847986-13-4)?

When handling Ethyl 2,2-difluoro-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoate (CAS: 84798...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...