Compound Q&A

What industries use N-Boc Palbociclib (CAS: 1651214-74-2)?

Answer

N-Boc Palbociclib
N-Boc Palbociclib is primarily used in the pharmaceutical industry for the development of anti-cancer drugs. It is also utilized in research settings for studying cellular processes and drug mechanisms. While not commonly found in other industries, its applications in polymers and sensors are increasingly explored due to its chemical versatility. CAS: 1651214-74-2

About

English Name N-Boc Palbociclib
Molecular Formula C29H37N7O4
Molecular Weight 547.66 g/mol
SMILES CC(=O)c1c(C)c2cnc(Nc3ccc(cn3)N4CCN(CC4)C(=O)OC(C)(C)C)nc2n(C5CCCC5)c1=O
InChIKey QVJKVBFRYVEWGO-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Boc Palbociclib (CAS: 1651214-74-2)?

N-Boc Palbociclib is a crystalline compound with a molecular weight of approximately 555.7 g/mol. It...

Compound Q&A

How is N-Boc Palbociclib (CAS: 1651214-74-2) typically synthesized?

N-Boc Palbociclib is synthesized through a multistep process involving protective group chemistry, s...

Compound Q&A

What precautions should be taken when handling N-Boc Palbociclib (CAS: 1651214-74-2)?

When handling N-Boc Palbociclib (CAS: 1651214-74-2), it is essential to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...